About [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate
[1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate (PubChem CID 86881216) has the molecular formula C19H12F3N5O3
and a molecular weight of 415.33 g/mol. Its IUPAC name is [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate.
Molecular Properties
| Compound Name | [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate |
| PubChem CID | 86881216 |
| Molecular Formula | C19H12F3N5O3 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate |
| SMILES | O=C(OCc1cn(-c2ccc(C(F)(F)F)cn2)nn1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C19H12F3N5O3/c20-19(21,22)14-5-6-17(24-7-14)27-9-15(25-26-27)10-29-18(28)13-3-1-12(2-4-13)16-8-23-11-30-16/h1-9,11H,10H2 |
| InChIKey | KMJQMYCEADVIQP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate?
The IUPAC name of [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate (CID 86881216) is [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate.
What is the SMILES notation for [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate?
The canonical SMILES for [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate is O=C(OCc1cn(-c2ccc(C(F)(F)F)cn2)nn1)c1ccc(-c2cnco2)cc1.
What is the InChIKey of [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate?
The InChIKey is KMJQMYCEADVIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N5O3/c20-19(21,22)14-5-6-17(24-7-14)27-9-15(25-26-27)10-29-18(28)13-3-1-12(2-4-13)16-8-23-11-30-16/h1-9,11H,10H2.
What are the key properties of [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate?
[1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate has a molecular weight of 415.33 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methyl 4-(1,3-oxazol-5-yl)benzoate is sourced from PubChem (CID 86881216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).