About 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide
2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide (PubChem CID 86881521) has the molecular formula C24H21ClN2O4
and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide |
| PubChem CID | 86881521 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide |
| SMILES | CNC(=O)c1c(C)cccc1NC(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O4/c1-15-4-3-5-20(22(15)24(30)26-2)27-21(28)14-31-19-12-8-17(9-13-19)23(29)16-6-10-18(25)11-7-16/h3-13H,14H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | ITLVMADCAAJSKF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide?
The IUPAC name of 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide (CID 86881521) is 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide.
What is the SMILES notation for 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide?
The canonical SMILES for 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide is CNC(=O)c1c(C)cccc1NC(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1.
What is the InChIKey of 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide?
The InChIKey is ITLVMADCAAJSKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21ClN2O4/c1-15-4-3-5-20(22(15)24(30)26-2)27-21(28)14-31-19-12-8-17(9-13-19)23(29)16-6-10-18(25)11-7-16/h3-13H,14H2,1-2H3,(H,26,30)(H,27,28).
What are the key properties of 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide?
2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide has a molecular weight of 436.90 g/mol, XLogP of 4.26, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]amino]-N,6-dimethylbenzamide is sourced from PubChem (CID 86881521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).