C22H24ClN5O — CID 86882662
1-[[1-(7-chloroquinazolin-4-yl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea (PubChem CID 86882662) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 1-[[1-(7-chloroquinazolin-4-yl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[1-(7-chloroquinazolin-4-yl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 86882662 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[[1-(7-chloroquinazolin-4-yl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCC2CCCN(c3ncnc4cc(Cl)ccc34)C2)cc1 |
| InChI | InChI=1S/C22H24ClN5O/c1-15-4-7-18(8-5-15)27-22(29)24-12-16-3-2-10-28(13-16)21-19-9-6-17(23)11-20(19)25-14-26-21/h4-9,11,14,16H,2-3,10,12-13H2,1H3,(H2,24,27,29) |
| InChIKey | NDCVSISJOBJZQY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |