C23H26N6O2 — CID 86883409
1-[5-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 86883409) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-[5-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 86883409 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-[5-[(1-benzyl-5-methylpyrazole-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCCC(C(N)=O)C3)nc2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N6O2/c1-16-20(13-26-29(16)14-17-6-3-2-4-7-17)23(31)27-19-9-10-21(25-12-19)28-11-5-8-18(15-28)22(24)30/h2-4,6-7,9-10,12-13,18H,5,8,11,14-15H2,1H3,(H2,24,30)(H,27,31) |
| InChIKey | CLBUMFDHJYHGOP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |