C22H27ClN2O3S — CID 86883702
1-benzylsulfonyl-N-[2-(4-chlorophenyl)propan-2-yl]piperidine-4-carboxamide (PubChem CID 86883702) has the molecular formula C22H27ClN2O3S and a molecular weight of 434.99 g/mol. Its IUPAC name is 1-benzylsulfonyl-N-[2-(4-chlorophenyl)propan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-benzylsulfonyl-N-[2-(4-chlorophenyl)propan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86883702 |
| Molecular Formula | C22H27ClN2O3S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-benzylsulfonyl-N-[2-(4-chlorophenyl)propan-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)(NC(=O)C1CCN(S(=O)(=O)Cc2ccccc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O3S/c1-22(2,19-8-10-20(23)11-9-19)24-21(26)18-12-14-25(15-13-18)29(27,28)16-17-6-4-3-5-7-17/h3-11,18H,12-16H2,1-2H3,(H,24,26) |
| InChIKey | LYWAMOWCWPCOHV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |