C21H25N3O3 — CID 8688433
N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-phenylpiperazin-1-yl)acetamide (PubChem CID 8688433) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-phenylpiperazin-1-yl)acetamide.
| Compound Name | N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-phenylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 8688433 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-phenylpiperazin-1-yl)acetamide |
| SMILES | C[C@@H](NC(=O)CN1CCN(c2ccccc2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H25N3O3/c1-16(17-7-8-19-20(13-17)27-15-26-19)22-21(25)14-23-9-11-24(12-10-23)18-5-3-2-4-6-18/h2-8,13,16H,9-12,14-15H2,1H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | OWKYDQPHVAGAGB-MRXNPFEDSA-N |
| XLogP | 2.41 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |