About 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine
6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 86884768) has the molecular formula C17H15ClF2O5S
and a molecular weight of 404.82 g/mol. Its IUPAC name is 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 86884768 |
| Molecular Formula | C17H15ClF2O5S |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC(c1ccc(OC(F)F)cc1)S(=O)(=O)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C17H15ClF2O5S/c1-10(11-2-4-12(5-3-11)25-17(19)20)26(21,22)16-9-15-14(8-13(16)18)23-6-7-24-15/h2-5,8-10,17H,6-7H2,1H3 |
| InChIKey | DPYNGOJMBJYVMV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine (CID 86884768) is 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine is CC(c1ccc(OC(F)F)cc1)S(=O)(=O)c1cc2c(cc1Cl)OCCO2.
What is the InChIKey of 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine?
The InChIKey is DPYNGOJMBJYVMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClF2O5S/c1-10(11-2-4-12(5-3-11)25-17(19)20)26(21,22)16-9-15-14(8-13(16)18)23-6-7-24-15/h2-5,8-10,17H,6-7H2,1H3.
What are the key properties of 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine?
6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine has a molecular weight of 404.82 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-[1-[4-(difluoromethoxy)phenyl]ethylsulfonyl]-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 86884768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).