C25H31N3O3 — CID 86887844
N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-3-(2-methoxyphenyl)butanamide (PubChem CID 86887844) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-3-(2-methoxyphenyl)butanamide.
| Compound Name | N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-3-(2-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 86887844 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-3-(2-methoxyphenyl)butanamide |
| SMILES | CCN(CC)C(=O)Cn1ccc2cc(NC(=O)CC(C)c3ccccc3OC)ccc21 |
| InChI | InChI=1S/C25H31N3O3/c1-5-27(6-2)25(30)17-28-14-13-19-16-20(11-12-22(19)28)26-24(29)15-18(3)21-9-7-8-10-23(21)31-4/h7-14,16,18H,5-6,15,17H2,1-4H3,(H,26,29) |
| InChIKey | RDRKRXSZDPHAGV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |