C19H20N4O3 — CID 86888161
2-[3-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 86888161) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[3-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86888161 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[3-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | Cn1cc(C2CCCN2C(=O)CCN2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C19H20N4O3/c1-21-12-13(11-20-21)16-7-4-9-22(16)17(24)8-10-23-18(25)14-5-2-3-6-15(14)19(23)26/h2-3,5-6,11-12,16H,4,7-10H2,1H3 |
| InChIKey | AJFOTKFMTGXDJP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|