C21H20F3N3O3 — CID 86888173
3-[(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 86888173) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 3-[(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86888173 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-[(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)CN(CN1C(=O)NC(c3ccccc3)(C(F)(F)F)C1=O)CC2 |
| InChI | InChI=1S/C21H20F3N3O3/c1-30-17-8-7-14-9-10-26(12-15(14)11-17)13-27-18(28)20(21(22,23)24,25-19(27)29)16-5-3-2-4-6-16/h2-8,11H,9-10,12-13H2,1H3,(H,25,29) |
| InChIKey | LJKCAUXLGBMLME-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|