C22H28ClN3O3S — CID 86888638
1-[1-(4-chlorophenyl)cyclobutyl]-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea (PubChem CID 86888638) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclobutyl]-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[1-(4-chlorophenyl)cyclobutyl]-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86888638 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclobutyl]-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea |
| SMILES | CC(C)NS(=O)(=O)Cc1ccc(CNC(=O)NC2(c3ccc(Cl)cc3)CCC2)cc1 |
| InChI | InChI=1S/C22H28ClN3O3S/c1-16(2)26-30(28,29)15-18-6-4-17(5-7-18)14-24-21(27)25-22(12-3-13-22)19-8-10-20(23)11-9-19/h4-11,16,26H,3,12-15H2,1-2H3,(H2,24,25,27) |
| InChIKey | VXRKUFOZAUBUQI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |