C17H22O4 — CID 86888711
2-butoxyethyl 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 86888711) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-butoxyethyl 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | 2-butoxyethyl 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 86888711 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-butoxyethyl 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | CCCCOCCOC(=O)Cc1coc2cc(C)ccc12 |
| InChI | InChI=1S/C17H22O4/c1-3-4-7-19-8-9-20-17(18)11-14-12-21-16-10-13(2)5-6-15(14)16/h5-6,10,12H,3-4,7-9,11H2,1-2H3 |
| InChIKey | LITSBYXBYXPNGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|