C18H19ClF2N2O2 — CID 8688905
N-[2-(4-chlorophenoxy)ethyl]-2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]acetamide (PubChem CID 8688905) has the molecular formula C18H19ClF2N2O2 and a molecular weight of 368.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8688905 |
| Molecular Formula | C18H19ClF2N2O2 |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)NCCOc1ccc(Cl)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H19ClF2N2O2/c1-12(16-7-4-14(20)10-17(16)21)23-11-18(24)22-8-9-25-15-5-2-13(19)3-6-15/h2-7,10,12,23H,8-9,11H2,1H3,(H,22,24)/t12-/m0/s1 |
| InChIKey | KWCNSNXJWPGREQ-LBPRGKRZSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|