About 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate
1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate (PubChem CID 86889931) has the molecular formula C15H18N2O2S
and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate |
| PubChem CID | 86889931 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OC(C)C2CC2)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C15H18N2O2S/c1-9-8-13(14(18)19-11(3)12-4-5-12)10(2)17(9)15-16-6-7-20-15/h6-8,11-12H,4-5H2,1-3H3 |
| InChIKey | FHVNCWCDTHSKIU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate?
The IUPAC name of 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate (CID 86889931) is 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate.
What is the SMILES notation for 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate?
The canonical SMILES for 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate is Cc1cc(C(=O)OC(C)C2CC2)c(C)n1-c1nccs1.
What is the InChIKey of 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate?
The InChIKey is FHVNCWCDTHSKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-9-8-13(14(18)19-11(3)12-4-5-12)10(2)17(9)15-16-6-7-20-15/h6-8,11-12H,4-5H2,1-3H3.
What are the key properties of 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate?
1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate has a molecular weight of 290.39 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylethyl 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carboxylate is sourced from PubChem (CID 86889931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).