C20H17Cl2N3O2 — CID 86890336
N-[bis(4-chlorophenyl)methyl]-2-(3-methyl-6-oxopyridazin-1-yl)acetamide (PubChem CID 86890336) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is N-[bis(4-chlorophenyl)methyl]-2-(3-methyl-6-oxopyridazin-1-yl)acetamide.
| Compound Name | N-[bis(4-chlorophenyl)methyl]-2-(3-methyl-6-oxopyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 86890336 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[bis(4-chlorophenyl)methyl]-2-(3-methyl-6-oxopyridazin-1-yl)acetamide |
| SMILES | Cc1ccc(=O)n(CC(=O)NC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c1-13-2-11-19(27)25(24-13)12-18(26)23-20(14-3-7-16(21)8-4-14)15-5-9-17(22)10-6-15/h2-11,20H,12H2,1H3,(H,23,26) |
| InChIKey | CSHQSKQBYFKFGP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |