C17H15ClN4 — CID 86890516
2-[3-(benzimidazol-1-yl)propylamino]-5-chlorobenzonitrile (PubChem CID 86890516) has the molecular formula C17H15ClN4 and a molecular weight of 310.79 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propylamino]-5-chlorobenzonitrile.
| Compound Name | 2-[3-(benzimidazol-1-yl)propylamino]-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 86890516 |
| Molecular Formula | C17H15ClN4 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propylamino]-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1NCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C17H15ClN4/c18-14-6-7-15(13(10-14)11-19)20-8-3-9-22-12-21-16-4-1-2-5-17(16)22/h1-2,4-7,10,12,20H,3,8-9H2 |
| InChIKey | VFLLICNNARVQBE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|