C17H16F5NO3S — CID 86893223
2-fluoro-4-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide (PubChem CID 86893223) has the molecular formula C17H16F5NO3S and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-fluoro-4-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide.
| Compound Name | 2-fluoro-4-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86893223 |
| Molecular Formula | C17H16F5NO3S |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-fluoro-4-methyl-N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(COCC(F)(F)C(F)F)c2)c(F)c1 |
| InChI | InChI=1S/C17H16F5NO3S/c1-11-5-6-15(14(18)7-11)27(24,25)23-13-4-2-3-12(8-13)9-26-10-17(21,22)16(19)20/h2-8,16,23H,9-10H2,1H3 |
| InChIKey | FTAQNASMWAHECY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|