C15H19BrN4S — CID 86894511
N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1-(1-pyridazin-3-ylpyrrolidin-2-yl)methanamine (PubChem CID 86894511) has the molecular formula C15H19BrN4S and a molecular weight of 367.32 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1-(1-pyridazin-3-ylpyrrolidin-2-yl)methanamine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1-(1-pyridazin-3-ylpyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 86894511 |
| Molecular Formula | C15H19BrN4S |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1-(1-pyridazin-3-ylpyrrolidin-2-yl)methanamine |
| SMILES | CN(Cc1csc(Br)c1)CC1CCCN1c1cccnn1 |
| InChI | InChI=1S/C15H19BrN4S/c1-19(9-12-8-14(16)21-11-12)10-13-4-3-7-20(13)15-5-2-6-17-18-15/h2,5-6,8,11,13H,3-4,7,9-10H2,1H3 |
| InChIKey | ALUCSYWQVIYTHM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |