C17H21FN4O2 — CID 86895699
5-[(5-fluoro-2-nitrophenyl)methyl]-1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 86895699) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 5-[(5-fluoro-2-nitrophenyl)methyl]-1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | 5-[(5-fluoro-2-nitrophenyl)methyl]-1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 86895699 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5-[(5-fluoro-2-nitrophenyl)methyl]-1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | CC(C)c1nc2c(n1C)CCN(Cc1cc(F)ccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C17H21FN4O2/c1-11(2)17-19-14-10-21(7-6-16(14)20(17)3)9-12-8-13(18)4-5-15(12)22(23)24/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | WMDHDZGVAAVBBG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|