C15H17BrN2OS — CID 86896043
1-[(4-bromophenyl)methyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea (PubChem CID 86896043) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 86896043 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea |
| SMILES | Cc1ccc(C(C)NC(=O)NCc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C15H17BrN2OS/c1-10-3-8-14(20-10)11(2)18-15(19)17-9-12-4-6-13(16)7-5-12/h3-8,11H,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | CDPNGJNPYPSJLU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |