C17H20BrNO2S — CID 86897384
3-(4-bromothiophen-2-yl)-N-[1-(4-ethoxyphenyl)ethyl]propanamide (PubChem CID 86897384) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is 3-(4-bromothiophen-2-yl)-N-[1-(4-ethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(4-bromothiophen-2-yl)-N-[1-(4-ethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 86897384 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3-(4-bromothiophen-2-yl)-N-[1-(4-ethoxyphenyl)ethyl]propanamide |
| SMILES | CCOc1ccc(C(C)NC(=O)CCc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C17H20BrNO2S/c1-3-21-15-6-4-13(5-7-15)12(2)19-17(20)9-8-16-10-14(18)11-22-16/h4-7,10-12H,3,8-9H2,1-2H3,(H,19,20) |
| InChIKey | KHFMWJOXVWVIEF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |