C22H22ClFN2O3 — CID 86897729
1-(2-chlorophenyl)-N-[4-(4-fluorophenyl)oxan-4-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 86897729) has the molecular formula C22H22ClFN2O3 and a molecular weight of 416.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[4-(4-fluorophenyl)oxan-4-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[4-(4-fluorophenyl)oxan-4-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86897729 |
| Molecular Formula | C22H22ClFN2O3 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[4-(4-fluorophenyl)oxan-4-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC1(c2ccc(F)cc2)CCOCC1)C1CC(=O)N(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C22H22ClFN2O3/c23-18-3-1-2-4-19(18)26-14-15(13-20(26)27)21(28)25-22(9-11-29-12-10-22)16-5-7-17(24)8-6-16/h1-8,15H,9-14H2,(H,25,28) |
| InChIKey | BLMOCUDFAVOKQY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |