C25H19ClN4O — CID 86899315
6-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyridine-3-carbonitrile (PubChem CID 86899315) has the molecular formula C25H19ClN4O and a molecular weight of 426.91 g/mol. Its IUPAC name is 6-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 86899315 |
| Molecular Formula | C25H19ClN4O |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 6-[4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyridine-3-carbonitrile |
| SMILES | CC1c2[nH]c3ccccc3c2C(c2ccccc2Cl)CN1C(=O)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C25H19ClN4O/c1-15-24-23(18-7-3-5-9-21(18)29-24)19(17-6-2-4-8-20(17)26)14-30(15)25(31)22-11-10-16(12-27)13-28-22/h2-11,13,15,19,29H,14H2,1H3 |
| InChIKey | VETGTEXVLNETFN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|