C25H31FN4O2 — CID 86899681
1-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]-3-[3-(1H-indol-3-yl)propyl]urea (PubChem CID 86899681) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]-3-[3-(1H-indol-3-yl)propyl]urea.
| Compound Name | 1-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]-3-[3-(1H-indol-3-yl)propyl]urea |
|---|---|
| PubChem CID | 86899681 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]-3-[3-(1H-indol-3-yl)propyl]urea |
| SMILES | CC(NC(=O)NCCCc1c[nH]c2ccccc12)c1cc(F)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C25H31FN4O2/c1-17(22-15-19(26)8-9-24(22)30-13-10-20(31)11-14-30)29-25(32)27-12-4-5-18-16-28-23-7-3-2-6-21(18)23/h2-3,6-9,15-17,20,28,31H,4-5,10-14H2,1H3,(H2,27,29,32) |
| InChIKey | HBFLLYUIWDDVQN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|