C26H27FN2O3 — CID 86899757
2-[[4-(4-fluorophenyl)oxan-4-yl]amino]-N-[2-(4-methylphenoxy)phenyl]acetamide (PubChem CID 86899757) has the molecular formula C26H27FN2O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)oxan-4-yl]amino]-N-[2-(4-methylphenoxy)phenyl]acetamide.
| Compound Name | 2-[[4-(4-fluorophenyl)oxan-4-yl]amino]-N-[2-(4-methylphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 86899757 |
| Molecular Formula | C26H27FN2O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)oxan-4-yl]amino]-N-[2-(4-methylphenoxy)phenyl]acetamide |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)CNC2(c3ccc(F)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C26H27FN2O3/c1-19-6-12-22(13-7-19)32-24-5-3-2-4-23(24)29-25(30)18-28-26(14-16-31-17-15-26)20-8-10-21(27)11-9-20/h2-13,28H,14-18H2,1H3,(H,29,30) |
| InChIKey | RISMLOZXFALGBL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |