C24H28N4O3 — CID 86899900
N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 86899900) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 86899900 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | COCCOc1ccc(CNC(=O)c2nn(-c3ccc(C)cc3)c3c2CCCC3)cn1 |
| InChI | InChI=1S/C24H28N4O3/c1-17-7-10-19(11-8-17)28-21-6-4-3-5-20(21)23(27-28)24(29)26-16-18-9-12-22(25-15-18)31-14-13-30-2/h7-12,15H,3-6,13-14,16H2,1-2H3,(H,26,29) |
| InChIKey | REDDDMSKKZXCQN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|