About (3-hydroxyphenyl) benzoate
(3-hydroxyphenyl) benzoate (PubChem CID 8690) has the molecular formula C13H10O3
and a molecular weight of 214.22 g/mol. Its IUPAC name is (3-hydroxyphenyl) benzoate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) benzoate |
| PubChem CID | 8690 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (3-hydroxyphenyl) benzoate |
| SMILES | O=C(Oc1cccc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C13H10O3/c14-11-7-4-8-12(9-11)16-13(15)10-5-2-1-3-6-10/h1-9,14H |
| InChIKey | GDESWOTWNNGOMW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) benzoate?
The IUPAC name of (3-hydroxyphenyl) benzoate (CID 8690) is (3-hydroxyphenyl) benzoate.
What is the SMILES notation for (3-hydroxyphenyl) benzoate?
The canonical SMILES for (3-hydroxyphenyl) benzoate is O=C(Oc1cccc(O)c1)c1ccccc1.
What is the InChIKey of (3-hydroxyphenyl) benzoate?
The InChIKey is GDESWOTWNNGOMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3/c14-11-7-4-8-12(9-11)16-13(15)10-5-2-1-3-6-10/h1-9,14H.
What are the key properties of (3-hydroxyphenyl) benzoate?
(3-hydroxyphenyl) benzoate has a molecular weight of 214.22 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) benzoate is sourced from PubChem (CID 8690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).