C19H17FN4O3S — CID 86900766
N-[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-5-(propanoylamino)benzamide (PubChem CID 86900766) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-5-(propanoylamino)benzamide.
| Compound Name | N-[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-5-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 86900766 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-5-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(O)c(C(=O)Nc2nnc(Cc3ccccc3F)s2)c1 |
| InChI | InChI=1S/C19H17FN4O3S/c1-2-16(26)21-12-7-8-15(25)13(10-12)18(27)22-19-24-23-17(28-19)9-11-5-3-4-6-14(11)20/h3-8,10,25H,2,9H2,1H3,(H,21,26)(H,22,24,27) |
| InChIKey | SJKDMRLLSALNGO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|