C16H15FN4OS2 — CID 86901024
N-(2-fluorophenyl)-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 86901024) has the molecular formula C16H15FN4OS2 and a molecular weight of 362.46 g/mol. Its IUPAC name is N-(2-fluorophenyl)-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-fluorophenyl)-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 86901024 |
| Molecular Formula | C16H15FN4OS2 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-(2-fluorophenyl)-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1ccccc1Nc1nnc(SCc2noc3c2CCCC3)s1 |
| InChI | InChI=1S/C16H15FN4OS2/c17-11-6-2-3-7-12(11)18-15-19-20-16(24-15)23-9-13-10-5-1-4-8-14(10)22-21-13/h2-3,6-7H,1,4-5,8-9H2,(H,18,19) |
| InChIKey | FFSAAEDCBPUYKG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |