C19H22N4O2S2 — CID 86901033
3-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 86901033) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 3-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 86901033 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | c1csc(-c2nnc(SCc3noc4c3CCCC4)n2CC2CCCO2)c1 |
| InChI | InChI=1S/C19H22N4O2S2/c1-2-7-16-14(6-1)15(22-25-16)12-27-19-21-20-18(17-8-4-10-26-17)23(19)11-13-5-3-9-24-13/h4,8,10,13H,1-3,5-7,9,11-12H2 |
| InChIKey | BEGSZOHYMMUXPZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |