C20H21N5O3S — CID 86901136
1,7-dicyclopropyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 86901136) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 1,7-dicyclopropyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,7-dicyclopropyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 86901136 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1,7-dicyclopropyl-5-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylsulfanyl)pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CC2)c2nc(C3CC3)nc(SCc3noc4c3CCCC4)c12 |
| InChI | InChI=1S/C20H21N5O3S/c26-18-15-17(25(11-7-8-11)20(27)23-18)21-16(10-5-6-10)22-19(15)29-9-13-12-3-1-2-4-14(12)28-24-13/h10-11H,1-9H2,(H,23,26,27) |
| InChIKey | JIXIRKLOIRVVOP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |