C17H33NO2 — CID 86901393
3,4,4-trimethyl-N-(oxan-2-ylmethyl)-N-propylpentanamide (PubChem CID 86901393) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 3,4,4-trimethyl-N-(oxan-2-ylmethyl)-N-propylpentanamide.
| Compound Name | 3,4,4-trimethyl-N-(oxan-2-ylmethyl)-N-propylpentanamide |
|---|---|
| PubChem CID | 86901393 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 3,4,4-trimethyl-N-(oxan-2-ylmethyl)-N-propylpentanamide |
| SMILES | CCCN(CC1CCCCO1)C(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO2/c1-6-10-18(13-15-9-7-8-11-20-15)16(19)12-14(2)17(3,4)5/h14-15H,6-13H2,1-5H3 |
| InChIKey | HGWQENPAZMDDOE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |