C16H18ClNO2S — CID 86902100
3-[2-(2-chlorophenoxy)ethylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 86902100) has the molecular formula C16H18ClNO2S and a molecular weight of 323.84 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-[2-(2-chlorophenoxy)ethylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 86902100 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.84 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | Clc1ccccc1OCCSCc1noc2c1CCCC2 |
| InChI | InChI=1S/C16H18ClNO2S/c17-13-6-2-4-8-16(13)19-9-10-21-11-14-12-5-1-3-7-15(12)20-18-14/h2,4,6,8H,1,3,5,7,9-11H2 |
| InChIKey | YAGYEFZIFJUXLC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|