C20H22N8O2 — CID 86902624
3-(5-phenyltetrazol-2-yl)propyl 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 86902624) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 3-(5-phenyltetrazol-2-yl)propyl 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | 3-(5-phenyltetrazol-2-yl)propyl 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 86902624 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-(5-phenyltetrazol-2-yl)propyl 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1nc2ncnn2c(C)c1CCC(=O)OCCCn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N8O2/c1-14-17(15(2)28-20(23-14)21-13-22-28)9-10-18(29)30-12-6-11-27-25-19(24-26-27)16-7-4-3-5-8-16/h3-5,7-8,13H,6,9-12H2,1-2H3 |
| InChIKey | YCYYPUVXKIEVFZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 112.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|