About (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide
(4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide (PubChem CID 869028) has the molecular formula C8H11N5O3
and a molecular weight of 225.21 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide.
Molecular Properties
| Compound Name | (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide |
| PubChem CID | 869028 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide |
| SMILES | COCN(C#N)c1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C8H11N5O3/c1-14-5-13(4-9)6-10-7(15-2)12-8(11-6)16-3/h5H2,1-3H3 |
| InChIKey | TUWDPWSZHGLVHH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 93.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide?
The IUPAC name of (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide (CID 869028) is (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide.
What is the SMILES notation for (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide?
The canonical SMILES for (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide is COCN(C#N)c1nc(OC)nc(OC)n1.
What is the InChIKey of (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide?
The InChIKey is TUWDPWSZHGLVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O3/c1-14-5-13(4-9)6-10-7(15-2)12-8(11-6)16-3/h5H2,1-3H3.
What are the key properties of (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide?
(4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide has a molecular weight of 225.21 g/mol, XLogP of -0.22, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethoxy-1,3,5-triazin-2-yl)-(methoxymethyl)cyanamide is sourced from PubChem (CID 869028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).