C21H30N4O3S — CID 86903057
2-[4-[ethylsulfonyl(methyl)amino]piperidin-1-yl]-N-(2-quinolin-8-ylethyl)acetamide (PubChem CID 86903057) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-[4-[ethylsulfonyl(methyl)amino]piperidin-1-yl]-N-(2-quinolin-8-ylethyl)acetamide.
| Compound Name | 2-[4-[ethylsulfonyl(methyl)amino]piperidin-1-yl]-N-(2-quinolin-8-ylethyl)acetamide |
|---|---|
| PubChem CID | 86903057 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[4-[ethylsulfonyl(methyl)amino]piperidin-1-yl]-N-(2-quinolin-8-ylethyl)acetamide |
| SMILES | CCS(=O)(=O)N(C)C1CCN(CC(=O)NCCc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C21H30N4O3S/c1-3-29(27,28)24(2)19-10-14-25(15-11-19)16-20(26)22-13-9-18-7-4-6-17-8-5-12-23-21(17)18/h4-8,12,19H,3,9-11,13-16H2,1-2H3,(H,22,26) |
| InChIKey | XWSKBYSMXKXZSC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |