About 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one
4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one (PubChem CID 86903858) has the molecular formula C19H29N3O3
and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one |
| PubChem CID | 86903858 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one |
| SMILES | CCC(CC)CN(CC)CC(O)Cn1c(-c2ccccc2)noc1=O |
| InChI | InChI=1S/C19H29N3O3/c1-4-15(5-2)12-21(6-3)13-17(23)14-22-18(20-25-19(22)24)16-10-8-7-9-11-16/h7-11,15,17,23H,4-6,12-14H2,1-3H3 |
| InChIKey | KKSFOJLNUYAZFE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one?
The IUPAC name of 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one (CID 86903858) is 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one?
The canonical SMILES for 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one is CCC(CC)CN(CC)CC(O)Cn1c(-c2ccccc2)noc1=O.
What is the InChIKey of 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one?
The InChIKey is KKSFOJLNUYAZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O3/c1-4-15(5-2)12-21(6-3)13-17(23)14-22-18(20-25-19(22)24)16-10-8-7-9-11-16/h7-11,15,17,23H,4-6,12-14H2,1-3H3.
What are the key properties of 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one?
4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one has a molecular weight of 347.46 g/mol, XLogP of 2.62, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[ethyl(2-ethylbutyl)amino]-2-hydroxypropyl]-3-phenyl-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 86903858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).