C22H34N4O3S — CID 86904301
(Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]prop-2-enamide (PubChem CID 86904301) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 86904301 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)NC2CCN(CCS(C)(=O)=O)CC2)c(C)n1CC(C)C |
| InChI | InChI=1S/C22H34N4O3S/c1-16(2)15-26-17(3)12-19(18(26)4)13-20(14-23)22(27)24-21-6-8-25(9-7-21)10-11-30(5,28)29/h12-13,16,21H,6-11,15H2,1-5H3,(H,24,27)/b20-13- |
| InChIKey | YRNJCZGRIZHLBU-MOSHPQCFSA-N |
| XLogP | 2.29 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|