C25H24FN3O3 — CID 86906316
N-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethyl]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 86906316) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethyl]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethyl]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 86906316 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[2-(4-fluoro-1-methylbenzimidazol-2-yl)ethyl]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCc2nc3c(F)cccc3n2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H24FN3O3/c1-29-20-10-6-9-19(26)24(20)28-23(29)13-14-27-25(30)18-11-12-21(22(15-18)31-2)32-16-17-7-4-3-5-8-17/h3-12,15H,13-14,16H2,1-2H3,(H,27,30) |
| InChIKey | RXUWGNOVYQBQNJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |