C20H21N5O4 — CID 86909004
3-[1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 86909004) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 86909004 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=[N+]([O-])c1cc2c(c(CN3CCC(c4nnc5ccccn45)CC3)c1)OCOC2 |
| InChI | InChI=1S/C20H21N5O4/c26-25(27)17-9-15(19-16(10-17)12-28-13-29-19)11-23-7-4-14(5-8-23)20-22-21-18-3-1-2-6-24(18)20/h1-3,6,9-10,14H,4-5,7-8,11-13H2 |
| InChIKey | MPYLDIGWGSTSCA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|