C19H16ClNO4 — CID 86912166
N-[2-(2-chlorophenoxy)phenyl]-5-(methoxymethyl)furan-2-carboxamide (PubChem CID 86912166) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)phenyl]-5-(methoxymethyl)furan-2-carboxamide.
| Compound Name | N-[2-(2-chlorophenoxy)phenyl]-5-(methoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 86912166 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[2-(2-chlorophenoxy)phenyl]-5-(methoxymethyl)furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)Nc2ccccc2Oc2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H16ClNO4/c1-23-12-13-10-11-18(24-13)19(22)21-15-7-3-5-9-17(15)25-16-8-4-2-6-14(16)20/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | JJJMFBWRWJCZFI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |