methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate

C22H27NO3 — CID 86913313

IUPACmethyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(CCOC(c2ccccc2)c2ccccc2)CC1
InChIInChI=1S/C22H27NO3/c1-25-22(24)20-12-14-23(15-13-20)16-17-26-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20-21H,12-17H2,1H3
InChIKeyCSIVISVLNORHDS-UHFFFAOYSA-N
MW353.46 g/mol
LogP3.68
Rot. Bonds7

About methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate

methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate (PubChem CID 86913313) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate
PubChem CID86913313
Molecular FormulaC22H27NO3
Molecular Weight353.46 g/mol
Exact Mass353.20
IUPAC Namemethyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(CCOC(c2ccccc2)c2ccccc2)CC1
InChIInChI=1S/C22H27NO3/c1-25-22(24)20-12-14-23(15-13-20)16-17-26-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20-21H,12-17H2,1H3
InChIKeyCSIVISVLNORHDS-UHFFFAOYSA-N
XLogP3.68
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.46
LogP ≤ 53.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate (CID 86913313) is methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate is COC(=O)C1CCN(CCOC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate?
The InChIKey is CSIVISVLNORHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3/c1-25-22(24)20-12-14-23(15-13-20)16-17-26-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20-21H,12-17H2,1H3.
What are the key properties of methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate?
methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate has a molecular weight of 353.46 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-benzhydryloxyethyl)piperidine-4-carboxylate is sourced from PubChem (CID 86913313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).