C17H23NO — CID 86914488
cyclopropyl-[4-(2-phenylethyl)piperidin-1-yl]methanone (PubChem CID 86914488) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is cyclopropyl-[4-(2-phenylethyl)piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(2-phenylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86914488 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | cyclopropyl-[4-(2-phenylethyl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H23NO/c19-17(16-8-9-16)18-12-10-15(11-13-18)7-6-14-4-2-1-3-5-14/h1-5,15-16H,6-13H2 |
| InChIKey | BAVLULNRMQHRCQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |