C21H32N4O3 — CID 86916143
N-[1-(4-ethylphenyl)ethyl]-4-(2-morpholin-4-ylacetyl)piperazine-1-carboxamide (PubChem CID 86916143) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)ethyl]-4-(2-morpholin-4-ylacetyl)piperazine-1-carboxamide.
| Compound Name | N-[1-(4-ethylphenyl)ethyl]-4-(2-morpholin-4-ylacetyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86916143 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[1-(4-ethylphenyl)ethyl]-4-(2-morpholin-4-ylacetyl)piperazine-1-carboxamide |
| SMILES | CCc1ccc(C(C)NC(=O)N2CCN(C(=O)CN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C21H32N4O3/c1-3-18-4-6-19(7-5-18)17(2)22-21(27)25-10-8-24(9-11-25)20(26)16-23-12-14-28-15-13-23/h4-7,17H,3,8-16H2,1-2H3,(H,22,27) |
| InChIKey | UQIWHAUMFGFXEW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |