C18H24N2O4S — CID 86917257
methyl 3-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate (PubChem CID 86917257) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is methyl 3-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 86917257 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 3-[(1-cyclopentyl-5-oxopyrrolidine-3-carbonyl)amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)C1CC(=O)N(C2CCCC2)C1)c1cccs1 |
| InChI | InChI=1S/C18H24N2O4S/c1-24-17(22)10-14(15-7-4-8-25-15)19-18(23)12-9-16(21)20(11-12)13-5-2-3-6-13/h4,7-8,12-14H,2-3,5-6,9-11H2,1H3,(H,19,23) |
| InChIKey | WSDQLZCVSDDVOP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |