About (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate
(2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate (PubChem CID 86919782) has the molecular formula C16H16FNO2S
and a molecular weight of 305.37 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate |
| PubChem CID | 86919782 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate |
| SMILES | CCc1nc(COC(=O)C2CC2c2ccccc2F)cs1 |
| InChI | InChI=1S/C16H16FNO2S/c1-2-15-18-10(9-21-15)8-20-16(19)13-7-12(13)11-5-3-4-6-14(11)17/h3-6,9,12-13H,2,7-8H2,1H3 |
| InChIKey | AUQAFVSRZIUQFQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate?
The IUPAC name of (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate (CID 86919782) is (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate?
The canonical SMILES for (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate is CCc1nc(COC(=O)C2CC2c2ccccc2F)cs1.
What is the InChIKey of (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate?
The InChIKey is AUQAFVSRZIUQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO2S/c1-2-15-18-10(9-21-15)8-20-16(19)13-7-12(13)11-5-3-4-6-14(11)17/h3-6,9,12-13H,2,7-8H2,1H3.
What are the key properties of (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate?
(2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate has a molecular weight of 305.37 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1,3-thiazol-4-yl)methyl 2-(2-fluorophenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 86919782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).