About 2,3-dihydroxypropyl 4-aminobenzoate
2,3-dihydroxypropyl 4-aminobenzoate (PubChem CID 8692) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 4-aminobenzoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl 4-aminobenzoate |
| PubChem CID | 8692 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,3-dihydroxypropyl 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(O)CO)cc1 |
| InChI | InChI=1S/C10H13NO4/c11-8-3-1-7(2-4-8)10(14)15-6-9(13)5-12/h1-4,9,12-13H,5-6,11H2 |
| InChIKey | WHQOKFZWSDOTQP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 4-aminobenzoate?
The IUPAC name of 2,3-dihydroxypropyl 4-aminobenzoate (CID 8692) is 2,3-dihydroxypropyl 4-aminobenzoate.
What is the SMILES notation for 2,3-dihydroxypropyl 4-aminobenzoate?
The canonical SMILES for 2,3-dihydroxypropyl 4-aminobenzoate is Nc1ccc(C(=O)OCC(O)CO)cc1.
What is the InChIKey of 2,3-dihydroxypropyl 4-aminobenzoate?
The InChIKey is WHQOKFZWSDOTQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c11-8-3-1-7(2-4-8)10(14)15-6-9(13)5-12/h1-4,9,12-13H,5-6,11H2.
What are the key properties of 2,3-dihydroxypropyl 4-aminobenzoate?
2,3-dihydroxypropyl 4-aminobenzoate has a molecular weight of 211.22 g/mol, XLogP of -0.22, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 4-aminobenzoate is sourced from PubChem (CID 8692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).