C17H16N2O5 — CID 869200
methyl 3-[(2,4-dimethylphenyl)carbamoyl]-5-nitrobenzoate (PubChem CID 869200) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is methyl 3-[(2,4-dimethylphenyl)carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[(2,4-dimethylphenyl)carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 869200 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 3-[(2,4-dimethylphenyl)carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2ccc(C)cc2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N2O5/c1-10-4-5-15(11(2)6-10)18-16(20)12-7-13(17(21)24-3)9-14(8-12)19(22)23/h4-9H,1-3H3,(H,18,20) |
| InChIKey | LWKFZLKQRNRJDN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|