C16H18N2O5 — CID 86921232
methyl 6-[3-(furan-2-ylmethoxy)propylcarbamoyl]pyridine-3-carboxylate (PubChem CID 86921232) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl 6-[3-(furan-2-ylmethoxy)propylcarbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[3-(furan-2-ylmethoxy)propylcarbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 86921232 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl 6-[3-(furan-2-ylmethoxy)propylcarbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCCCOCc2ccco2)nc1 |
| InChI | InChI=1S/C16H18N2O5/c1-21-16(20)12-5-6-14(18-10-12)15(19)17-7-3-8-22-11-13-4-2-9-23-13/h2,4-6,9-10H,3,7-8,11H2,1H3,(H,17,19) |
| InChIKey | HLEZGGMYLBQGFW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|