C14H17N3O4S — CID 86921526
1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl 4-(thiophene-2-carbonylamino)butanoate (PubChem CID 86921526) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl 4-(thiophene-2-carbonylamino)butanoate.
| Compound Name | 1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl 4-(thiophene-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 86921526 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl 4-(thiophene-2-carbonylamino)butanoate |
| SMILES | Cc1noc(C(C)OC(=O)CCCNC(=O)c2cccs2)n1 |
| InChI | InChI=1S/C14H17N3O4S/c1-9(14-16-10(2)17-21-14)20-12(18)6-3-7-15-13(19)11-5-4-8-22-11/h4-5,8-9H,3,6-7H2,1-2H3,(H,15,19) |
| InChIKey | ZTDPZZZWNYVIGY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|